C18H17N3O3S — CID 47073572
2-(2-methylsulfonylethyl)-5,6-diphenyl-1,2,4-triazin-3-one (PubChem CID 47073572) has the molecular formula C18H17N3O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is 2-(2-methylsulfonylethyl)-5,6-diphenyl-1,2,4-triazin-3-one.
| Compound Name | 2-(2-methylsulfonylethyl)-5,6-diphenyl-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 47073572 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 2-(2-methylsulfonylethyl)-5,6-diphenyl-1,2,4-triazin-3-one |
| SMILES | CS(=O)(=O)CCn1nc(-c2ccccc2)c(-c2ccccc2)nc1=O |
| InChI | InChI=1S/C18H17N3O3S/c1-25(23,24)13-12-21-18(22)19-16(14-8-4-2-5-9-14)17(20-21)15-10-6-3-7-11-15/h2-11H,12-13H2,1H3 |
| InChIKey | BHPMCUXRKLNZAK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 81.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |