C16H16ClFN2O3S — CID 47075268
N-(3-chloro-4-fluorophenyl)-2-(N-methyl-4-methylsulfonylanilino)acetamide (PubChem CID 47075268) has the molecular formula C16H16ClFN2O3S and a molecular weight of 370.83 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-(N-methyl-4-methylsulfonylanilino)acetamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-(N-methyl-4-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 47075268 |
| Molecular Formula | C16H16ClFN2O3S |
| Molecular Weight | 370.83 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-(N-methyl-4-methylsulfonylanilino)acetamide |
| SMILES | CN(CC(=O)Nc1ccc(F)c(Cl)c1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C16H16ClFN2O3S/c1-20(12-4-6-13(7-5-12)24(2,22)23)10-16(21)19-11-3-8-15(18)14(17)9-11/h3-9H,10H2,1-2H3,(H,19,21) |
| InChIKey | SSUQJYVDQDSYKJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.83 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |