C16H15F2N5O2 — CID 47075722
1-(2,4-difluorophenyl)-3-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]urea (PubChem CID 47075722) has the molecular formula C16H15F2N5O2 and a molecular weight of 347.33 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]urea |
|---|---|
| PubChem CID | 47075722 |
| Molecular Formula | C16H15F2N5O2 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]urea |
| SMILES | O=C(NCCCn1nc2ccccn2c1=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C16H15F2N5O2/c17-11-5-6-13(12(18)10-11)20-15(24)19-7-3-9-23-16(25)22-8-2-1-4-14(22)21-23/h1-2,4-6,8,10H,3,7,9H2,(H2,19,20,24) |
| InChIKey | GZYJQSAIFWPOEQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 80.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|