C16H16ClN5O2 — CID 47075730
1-(2-chlorophenyl)-3-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]urea (PubChem CID 47075730) has the molecular formula C16H16ClN5O2 and a molecular weight of 345.79 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]urea.
| Compound Name | 1-(2-chlorophenyl)-3-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]urea |
|---|---|
| PubChem CID | 47075730 |
| Molecular Formula | C16H16ClN5O2 |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]urea |
| SMILES | O=C(NCCCn1nc2ccccn2c1=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C16H16ClN5O2/c17-12-6-1-2-7-13(12)19-15(23)18-9-5-11-22-16(24)21-10-4-3-8-14(21)20-22/h1-4,6-8,10H,5,9,11H2,(H2,18,19,23) |
| InChIKey | AVMCLJPJNDECDM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 80.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|