C18H22N4O3 — CID 47075956
1-[[3-(furan-2-ylmethylcarbamoylamino)phenyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 47075956) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is 1-[[3-(furan-2-ylmethylcarbamoylamino)phenyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[[3-(furan-2-ylmethylcarbamoylamino)phenyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 47075956 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 1-[[3-(furan-2-ylmethylcarbamoylamino)phenyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)C1CCCN1Cc1cccc(NC(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C18H22N4O3/c19-17(23)16-7-2-8-22(16)12-13-4-1-5-14(10-13)21-18(24)20-11-15-6-3-9-25-15/h1,3-6,9-10,16H,2,7-8,11-12H2,(H2,19,23)(H2,20,21,24) |
| InChIKey | XZBFNTRHLLSQSK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |