C29H27BrN2O6S — CID 4707654
2-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-7-bromo-1-(3-methoxy-4-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 4707654) has the molecular formula C29H27BrN2O6S and a molecular weight of 611.51 g/mol. Its IUPAC name is 2-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-7-bromo-1-(3-methoxy-4-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 2-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-7-bromo-1-(3-methoxy-4-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 4707654 |
| Molecular Formula | C29H27BrN2O6S |
| Molecular Weight | 611.51 g/mol |
| Exact Mass | 610.08 |
| IUPAC Name | 2-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-7-bromo-1-(3-methoxy-4-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCCOc1ccc(C2c3c(oc4ccc(Br)cc4c3=O)C(=O)N2c2nc(C)c(C(C)=O)s2)cc1OC |
| InChI | InChI=1S/C29H27BrN2O6S/c1-5-6-7-12-37-21-10-8-17(13-22(21)36-4)24-23-25(34)19-14-18(30)9-11-20(19)38-26(23)28(35)32(24)29-31-15(2)27(39-29)16(3)33/h8-11,13-14,24H,5-7,12H2,1-4H3 |
| InChIKey | POSZCQIOWDPCAN-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 98.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.51 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|