C23H24N4O4 — CID 47076615
N-(4-methyl-2-oxochromen-7-yl)-4-(phenylcarbamoylamino)piperidine-1-carboxamide (PubChem CID 47076615) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is N-(4-methyl-2-oxochromen-7-yl)-4-(phenylcarbamoylamino)piperidine-1-carboxamide.
| Compound Name | N-(4-methyl-2-oxochromen-7-yl)-4-(phenylcarbamoylamino)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 47076615 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | N-(4-methyl-2-oxochromen-7-yl)-4-(phenylcarbamoylamino)piperidine-1-carboxamide |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)N3CCC(NC(=O)Nc4ccccc4)CC3)ccc12 |
| InChI | InChI=1S/C23H24N4O4/c1-15-13-21(28)31-20-14-18(7-8-19(15)20)26-23(30)27-11-9-17(10-12-27)25-22(29)24-16-5-3-2-4-6-16/h2-8,13-14,17H,9-12H2,1H3,(H,26,30)(H2,24,25,29) |
| InChIKey | AQEIXTBIZZLOBX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|