About 1-(1-hydroxy-4,4-dimethylpentan-3-yl)-3-pyridin-4-ylurea
1-(1-hydroxy-4,4-dimethylpentan-3-yl)-3-pyridin-4-ylurea (PubChem CID 47076624) has the molecular formula C13H21N3O2
and a molecular weight of 251.33 g/mol. Its IUPAC name is 1-(1-hydroxy-4,4-dimethylpentan-3-yl)-3-pyridin-4-ylurea.
Molecular Properties
| Compound Name | 1-(1-hydroxy-4,4-dimethylpentan-3-yl)-3-pyridin-4-ylurea |
| PubChem CID | 47076624 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 1-(1-hydroxy-4,4-dimethylpentan-3-yl)-3-pyridin-4-ylurea |
| SMILES | CC(C)(C)C(CCO)NC(=O)Nc1ccncc1 |
| InChI | InChI=1S/C13H21N3O2/c1-13(2,3)11(6-9-17)16-12(18)15-10-4-7-14-8-5-10/h4-5,7-8,11,17H,6,9H2,1-3H3,(H2,14,15,16,18) |
| InChIKey | VIGGTSKQFVAIHZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1-hydroxy-4,4-dimethylpentan-3-yl)-3-pyridin-4-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-hydroxy-4,4-dimethylpentan-3-yl)-3-pyridin-4-ylurea?
The IUPAC name of 1-(1-hydroxy-4,4-dimethylpentan-3-yl)-3-pyridin-4-ylurea (CID 47076624) is 1-(1-hydroxy-4,4-dimethylpentan-3-yl)-3-pyridin-4-ylurea.
What is the SMILES notation for 1-(1-hydroxy-4,4-dimethylpentan-3-yl)-3-pyridin-4-ylurea?
The canonical SMILES for 1-(1-hydroxy-4,4-dimethylpentan-3-yl)-3-pyridin-4-ylurea is CC(C)(C)C(CCO)NC(=O)Nc1ccncc1.
What is the InChIKey of 1-(1-hydroxy-4,4-dimethylpentan-3-yl)-3-pyridin-4-ylurea?
The InChIKey is VIGGTSKQFVAIHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O2/c1-13(2,3)11(6-9-17)16-12(18)15-10-4-7-14-8-5-10/h4-5,7-8,11,17H,6,9H2,1-3H3,(H2,14,15,16,18).
What are the key properties of 1-(1-hydroxy-4,4-dimethylpentan-3-yl)-3-pyridin-4-ylurea?
1-(1-hydroxy-4,4-dimethylpentan-3-yl)-3-pyridin-4-ylurea has a molecular weight of 251.33 g/mol, XLogP of 2.00, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-hydroxy-4,4-dimethylpentan-3-yl)-3-pyridin-4-ylurea is sourced from PubChem (CID 47076624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).