C14H17N3O3S — CID 47077517
1-cyclopentyl-3-[(2-ethyl-1,3-thiazol-4-yl)methyl]imidazolidine-2,4,5-trione (PubChem CID 47077517) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is 1-cyclopentyl-3-[(2-ethyl-1,3-thiazol-4-yl)methyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-cyclopentyl-3-[(2-ethyl-1,3-thiazol-4-yl)methyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 47077517 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 1-cyclopentyl-3-[(2-ethyl-1,3-thiazol-4-yl)methyl]imidazolidine-2,4,5-trione |
| SMILES | CCc1nc(CN2C(=O)C(=O)N(C3CCCC3)C2=O)cs1 |
| InChI | InChI=1S/C14H17N3O3S/c1-2-11-15-9(8-21-11)7-16-12(18)13(19)17(14(16)20)10-5-3-4-6-10/h8,10H,2-7H2,1H3 |
| InChIKey | UPUMCPBGXAUKIH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|