About 5-chloro-2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]benzamide
5-chloro-2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]benzamide (PubChem CID 47077807) has the molecular formula C15H12ClF2N3O2
and a molecular weight of 339.73 g/mol. Its IUPAC name is 5-chloro-2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]benzamide.
Molecular Properties
| Compound Name | 5-chloro-2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]benzamide |
| PubChem CID | 47077807 |
| Molecular Formula | C15H12ClF2N3O2 |
| Molecular Weight | 339.73 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 5-chloro-2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]benzamide |
| SMILES | NC(=O)c1cc(Cl)ccc1NCC(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H12ClF2N3O2/c16-8-1-4-13(10(5-8)15(19)23)20-7-14(22)21-9-2-3-11(17)12(18)6-9/h1-6,20H,7H2,(H2,19,23)(H,21,22) |
| InChIKey | IJSNQMYOYYVOMF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.73 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]benzamide?
The IUPAC name of 5-chloro-2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]benzamide (CID 47077807) is 5-chloro-2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]benzamide.
What is the SMILES notation for 5-chloro-2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]benzamide?
The canonical SMILES for 5-chloro-2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]benzamide is NC(=O)c1cc(Cl)ccc1NCC(=O)Nc1ccc(F)c(F)c1.
What is the InChIKey of 5-chloro-2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]benzamide?
The InChIKey is IJSNQMYOYYVOMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClF2N3O2/c16-8-1-4-13(10(5-8)15(19)23)20-7-14(22)21-9-2-3-11(17)12(18)6-9/h1-6,20H,7H2,(H2,19,23)(H,21,22).
What are the key properties of 5-chloro-2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]benzamide?
5-chloro-2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]benzamide has a molecular weight of 339.73 g/mol, XLogP of 2.77, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]benzamide is sourced from PubChem (CID 47077807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).