C21H23N3O4S2 — CID 47078258
3-[2-hydroxy-3-(4-phenoxyphenoxy)propyl]-5-morpholin-4-yl-1,3,4-thiadiazole-2-thione (PubChem CID 47078258) has the molecular formula C21H23N3O4S2 and a molecular weight of 445.57 g/mol. Its IUPAC name is 3-[2-hydroxy-3-(4-phenoxyphenoxy)propyl]-5-morpholin-4-yl-1,3,4-thiadiazole-2-thione.
| Compound Name | 3-[2-hydroxy-3-(4-phenoxyphenoxy)propyl]-5-morpholin-4-yl-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 47078258 |
| Molecular Formula | C21H23N3O4S2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 3-[2-hydroxy-3-(4-phenoxyphenoxy)propyl]-5-morpholin-4-yl-1,3,4-thiadiazole-2-thione |
| SMILES | OC(COc1ccc(Oc2ccccc2)cc1)Cn1nc(N2CCOCC2)sc1=S |
| InChI | InChI=1S/C21H23N3O4S2/c25-16(14-24-21(29)30-20(22-24)23-10-12-26-13-11-23)15-27-17-6-8-19(9-7-17)28-18-4-2-1-3-5-18/h1-9,16,25H,10-15H2 |
| InChIKey | ABGODDZCJIPNEA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 68.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|