C18H21FN2O3S — CID 47078779
2-(4-fluorophenyl)-N-[2-methyl-3-(propylsulfonylamino)phenyl]acetamide (PubChem CID 47078779) has the molecular formula C18H21FN2O3S and a molecular weight of 364.44 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[2-methyl-3-(propylsulfonylamino)phenyl]acetamide.
| Compound Name | 2-(4-fluorophenyl)-N-[2-methyl-3-(propylsulfonylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 47078779 |
| Molecular Formula | C18H21FN2O3S |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[2-methyl-3-(propylsulfonylamino)phenyl]acetamide |
| SMILES | CCCS(=O)(=O)Nc1cccc(NC(=O)Cc2ccc(F)cc2)c1C |
| InChI | InChI=1S/C18H21FN2O3S/c1-3-11-25(23,24)21-17-6-4-5-16(13(17)2)20-18(22)12-14-7-9-15(19)10-8-14/h4-10,21H,3,11-12H2,1-2H3,(H,20,22) |
| InChIKey | SPOQPUONEWNERH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |