C22H25N3O2 — CID 47078833
3-methyl-N-[4-[[2-(1-methylindol-3-yl)acetyl]amino]phenyl]butanamide (PubChem CID 47078833) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 3-methyl-N-[4-[[2-(1-methylindol-3-yl)acetyl]amino]phenyl]butanamide.
| Compound Name | 3-methyl-N-[4-[[2-(1-methylindol-3-yl)acetyl]amino]phenyl]butanamide |
|---|---|
| PubChem CID | 47078833 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 3-methyl-N-[4-[[2-(1-methylindol-3-yl)acetyl]amino]phenyl]butanamide |
| SMILES | CC(C)CC(=O)Nc1ccc(NC(=O)Cc2cn(C)c3ccccc23)cc1 |
| InChI | InChI=1S/C22H25N3O2/c1-15(2)12-21(26)23-17-8-10-18(11-9-17)24-22(27)13-16-14-25(3)20-7-5-4-6-19(16)20/h4-11,14-15H,12-13H2,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | BHOYEPXZAJDARQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |