About N-cyclopropyl-N-(2,3-dihydro-1H-inden-1-yl)-5-nitrofuran-2-carboxamide
N-cyclopropyl-N-(2,3-dihydro-1H-inden-1-yl)-5-nitrofuran-2-carboxamide (PubChem CID 47079685) has the molecular formula C17H16N2O4
and a molecular weight of 312.32 g/mol. Its IUPAC name is N-cyclopropyl-N-(2,3-dihydro-1H-inden-1-yl)-5-nitrofuran-2-carboxamide.
Molecular Properties
| Compound Name | N-cyclopropyl-N-(2,3-dihydro-1H-inden-1-yl)-5-nitrofuran-2-carboxamide |
| PubChem CID | 47079685 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | N-cyclopropyl-N-(2,3-dihydro-1H-inden-1-yl)-5-nitrofuran-2-carboxamide |
| SMILES | O=C(c1ccc([N+](=O)[O-])o1)N(C1CC1)C1CCc2ccccc21 |
| InChI | InChI=1S/C17H16N2O4/c20-17(15-9-10-16(23-15)19(21)22)18(12-6-7-12)14-8-5-11-3-1-2-4-13(11)14/h1-4,9-10,12,14H,5-8H2 |
| InChIKey | QGPNAFJMQAHPPT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 76.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopropyl-N-(2,3-dihydro-1H-inden-1-yl)-5-nitrofuran-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-N-(2,3-dihydro-1H-inden-1-yl)-5-nitrofuran-2-carboxamide?
The IUPAC name of N-cyclopropyl-N-(2,3-dihydro-1H-inden-1-yl)-5-nitrofuran-2-carboxamide (CID 47079685) is N-cyclopropyl-N-(2,3-dihydro-1H-inden-1-yl)-5-nitrofuran-2-carboxamide.
What is the SMILES notation for N-cyclopropyl-N-(2,3-dihydro-1H-inden-1-yl)-5-nitrofuran-2-carboxamide?
The canonical SMILES for N-cyclopropyl-N-(2,3-dihydro-1H-inden-1-yl)-5-nitrofuran-2-carboxamide is O=C(c1ccc([N+](=O)[O-])o1)N(C1CC1)C1CCc2ccccc21.
What is the InChIKey of N-cyclopropyl-N-(2,3-dihydro-1H-inden-1-yl)-5-nitrofuran-2-carboxamide?
The InChIKey is QGPNAFJMQAHPPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O4/c20-17(15-9-10-16(23-15)19(21)22)18(12-6-7-12)14-8-5-11-3-1-2-4-13(11)14/h1-4,9-10,12,14H,5-8H2.
What are the key properties of N-cyclopropyl-N-(2,3-dihydro-1H-inden-1-yl)-5-nitrofuran-2-carboxamide?
N-cyclopropyl-N-(2,3-dihydro-1H-inden-1-yl)-5-nitrofuran-2-carboxamide has a molecular weight of 312.32 g/mol, XLogP of 3.48, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-N-(2,3-dihydro-1H-inden-1-yl)-5-nitrofuran-2-carboxamide is sourced from PubChem (CID 47079685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).