C16H14N2O2S — CID 47079795
ethyl 11-methyl-13-thia-8,10-diazatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,11,14-hexaene-15-carboxylate (PubChem CID 47079795) has the molecular formula C16H14N2O2S and a molecular weight of 298.37 g/mol. Its IUPAC name is ethyl 11-methyl-13-thia-8,10-diazatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,11,14-hexaene-15-carboxylate.
| Compound Name | ethyl 11-methyl-13-thia-8,10-diazatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,11,14-hexaene-15-carboxylate |
|---|---|
| PubChem CID | 47079795 |
| Molecular Formula | C16H14N2O2S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | ethyl 11-methyl-13-thia-8,10-diazatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,11,14-hexaene-15-carboxylate |
| SMILES | CCOC(=O)c1c2c3ccccc3[nH]c2n2c(C)csc12 |
| InChI | InChI=1S/C16H14N2O2S/c1-3-20-16(19)13-12-10-6-4-5-7-11(10)17-14(12)18-9(2)8-21-15(13)18/h4-8,17H,3H2,1-2H3 |
| InChIKey | USEKKZISMIRWOK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |