C19H28N4O3 — CID 47080011
1-[3-(3,4-dimethoxyphenyl)propyl]-3-[1-(1,5-dimethylpyrazol-4-yl)ethyl]urea (PubChem CID 47080011) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is 1-[3-(3,4-dimethoxyphenyl)propyl]-3-[1-(1,5-dimethylpyrazol-4-yl)ethyl]urea.
| Compound Name | 1-[3-(3,4-dimethoxyphenyl)propyl]-3-[1-(1,5-dimethylpyrazol-4-yl)ethyl]urea |
|---|---|
| PubChem CID | 47080011 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 1-[3-(3,4-dimethoxyphenyl)propyl]-3-[1-(1,5-dimethylpyrazol-4-yl)ethyl]urea |
| SMILES | COc1ccc(CCCNC(=O)NC(C)c2cnn(C)c2C)cc1OC |
| InChI | InChI=1S/C19H28N4O3/c1-13(16-12-21-23(3)14(16)2)22-19(24)20-10-6-7-15-8-9-17(25-4)18(11-15)26-5/h8-9,11-13H,6-7,10H2,1-5H3,(H2,20,22,24) |
| InChIKey | DYHGXIVVKBYRDK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|