C16H17BrN4S2 — CID 47080974
2-[[(5-bromothiophen-3-yl)methyl-methylamino]methyl]-5-(4-methylphenyl)-1H-1,2,4-triazole-3-thione (PubChem CID 47080974) has the molecular formula C16H17BrN4S2 and a molecular weight of 409.38 g/mol. Its IUPAC name is 2-[[(5-bromothiophen-3-yl)methyl-methylamino]methyl]-5-(4-methylphenyl)-1H-1,2,4-triazole-3-thione.
| Compound Name | 2-[[(5-bromothiophen-3-yl)methyl-methylamino]methyl]-5-(4-methylphenyl)-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 47080974 |
| Molecular Formula | C16H17BrN4S2 |
| Molecular Weight | 409.38 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | 2-[[(5-bromothiophen-3-yl)methyl-methylamino]methyl]-5-(4-methylphenyl)-1H-1,2,4-triazole-3-thione |
| SMILES | Cc1ccc(-c2nc(=S)n(CN(C)Cc3csc(Br)c3)[nH]2)cc1 |
| InChI | InChI=1S/C16H17BrN4S2/c1-11-3-5-13(6-4-11)15-18-16(22)21(19-15)10-20(2)8-12-7-14(17)23-9-12/h3-7,9H,8,10H2,1-2H3,(H,18,19,22) |
| InChIKey | FSUAWIKMTMMCJE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 36.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.38 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|