C12H9F3N2O2S — CID 47081557
2,2,2-trifluoroethyl N-[4-(1,3-thiazol-2-yl)phenyl]carbamate (PubChem CID 47081557) has the molecular formula C12H9F3N2O2S and a molecular weight of 302.28 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[4-(1,3-thiazol-2-yl)phenyl]carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-[4-(1,3-thiazol-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 47081557 |
| Molecular Formula | C12H9F3N2O2S |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[4-(1,3-thiazol-2-yl)phenyl]carbamate |
| SMILES | O=C(Nc1ccc(-c2nccs2)cc1)OCC(F)(F)F |
| InChI | InChI=1S/C12H9F3N2O2S/c13-12(14,15)7-19-11(18)17-9-3-1-8(2-4-9)10-16-5-6-20-10/h1-6H,7H2,(H,17,18) |
| InChIKey | DKQZEUQNBIVOEE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |