C12H17N3O3S — CID 47081758
(3S)-2-(dimethylsulfamoyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 47081758) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is (3S)-2-(dimethylsulfamoyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (3S)-2-(dimethylsulfamoyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 47081758 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (3S)-2-(dimethylsulfamoyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | CN(C)S(=O)(=O)N1Cc2ccccc2C[C@H]1C(N)=O |
| InChI | InChI=1S/C12H17N3O3S/c1-14(2)19(17,18)15-8-10-6-4-3-5-9(10)7-11(15)12(13)16/h3-6,11H,7-8H2,1-2H3,(H2,13,16)/t11-/m0/s1 |
| InChIKey | CYMAJRNZPQQMMG-NSHDSACASA-N |
| XLogP | -0.29 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |