About ethyl 2-[[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]amino]pyridine-3-carboxylate
ethyl 2-[[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]amino]pyridine-3-carboxylate (PubChem CID 47082826) has the molecular formula C18H29N3O3
and a molecular weight of 335.45 g/mol. Its IUPAC name is ethyl 2-[[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]amino]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]amino]pyridine-3-carboxylate |
| PubChem CID | 47082826 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | ethyl 2-[[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]amino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cccnc1NCC(C)(C)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C18H29N3O3/c1-6-23-17(22)15-8-7-9-19-16(15)20-12-18(4,5)21-10-13(2)24-14(3)11-21/h7-9,13-14H,6,10-12H2,1-5H3,(H,19,20) |
| InChIKey | RWTMVPKYJRDCSG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-[[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]amino]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]amino]pyridine-3-carboxylate?
The IUPAC name of ethyl 2-[[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]amino]pyridine-3-carboxylate (CID 47082826) is ethyl 2-[[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]amino]pyridine-3-carboxylate.
What is the SMILES notation for ethyl 2-[[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]amino]pyridine-3-carboxylate?
The canonical SMILES for ethyl 2-[[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]amino]pyridine-3-carboxylate is CCOC(=O)c1cccnc1NCC(C)(C)N1CC(C)OC(C)C1.
What is the InChIKey of ethyl 2-[[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]amino]pyridine-3-carboxylate?
The InChIKey is RWTMVPKYJRDCSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29N3O3/c1-6-23-17(22)15-8-7-9-19-16(15)20-12-18(4,5)21-10-13(2)24-14(3)11-21/h7-9,13-14H,6,10-12H2,1-5H3,(H,19,20).
What are the key properties of ethyl 2-[[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]amino]pyridine-3-carboxylate?
ethyl 2-[[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]amino]pyridine-3-carboxylate has a molecular weight of 335.45 g/mol, XLogP of 2.56, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]amino]pyridine-3-carboxylate is sourced from PubChem (CID 47082826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).