C11H18N4OS — CID 47083301
2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1-(oxolan-2-ylmethyl)guanidine (PubChem CID 47083301) has the molecular formula C11H18N4OS and a molecular weight of 254.36 g/mol. Its IUPAC name is 2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1-(oxolan-2-ylmethyl)guanidine.
| Compound Name | 2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1-(oxolan-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 47083301 |
| Molecular Formula | C11H18N4OS |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1-(oxolan-2-ylmethyl)guanidine |
| SMILES | Cc1nc(C/N=C(\N)NCC2CCCO2)cs1 |
| InChI | InChI=1S/C11H18N4OS/c1-8-15-9(7-17-8)5-13-11(12)14-6-10-3-2-4-16-10/h7,10H,2-6H2,1H3,(H3,12,13,14) |
| InChIKey | ULHWFOUDXPGNHO-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|