C21H19FN2O3S — CID 47084339
(6,7-dimethoxy-1-thiophen-2-yl-3,4-dihydro-1H-isoquinolin-2-yl)-(2-fluoro-4-pyridinyl)methanone (PubChem CID 47084339) has the molecular formula C21H19FN2O3S and a molecular weight of 398.46 g/mol. Its IUPAC name is (6,7-dimethoxy-1-thiophen-2-yl-3,4-dihydro-1H-isoquinolin-2-yl)-(2-fluoro-4-pyridinyl)methanone.
| Compound Name | (6,7-dimethoxy-1-thiophen-2-yl-3,4-dihydro-1H-isoquinolin-2-yl)-(2-fluoro-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 47084339 |
| Molecular Formula | C21H19FN2O3S |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | (6,7-dimethoxy-1-thiophen-2-yl-3,4-dihydro-1H-isoquinolin-2-yl)-(2-fluoro-4-pyridinyl)methanone |
| SMILES | COc1cc2c(cc1OC)C(c1cccs1)N(C(=O)c1ccnc(F)c1)CC2 |
| InChI | InChI=1S/C21H19FN2O3S/c1-26-16-10-13-6-8-24(21(25)14-5-7-23-19(22)11-14)20(18-4-3-9-28-18)15(13)12-17(16)27-2/h3-5,7,9-12,20H,6,8H2,1-2H3 |
| InChIKey | PQSMHCRGYHGESA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|