C15H19ClN2O6S — CID 47084546
methyl 5-chloro-2-[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethoxy]benzoate (PubChem CID 47084546) has the molecular formula C15H19ClN2O6S and a molecular weight of 390.85 g/mol. Its IUPAC name is methyl 5-chloro-2-[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethoxy]benzoate.
| Compound Name | methyl 5-chloro-2-[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 47084546 |
| Molecular Formula | C15H19ClN2O6S |
| Molecular Weight | 390.85 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | methyl 5-chloro-2-[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethoxy]benzoate |
| SMILES | COC(=O)c1cc(Cl)ccc1OCC(=O)N1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C15H19ClN2O6S/c1-23-15(20)12-9-11(16)3-4-13(12)24-10-14(19)17-5-7-18(8-6-17)25(2,21)22/h3-4,9H,5-8,10H2,1-2H3 |
| InChIKey | LVVGICLZXMSBGA-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.85 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |