C25H32ClN3O — CID 47084616
2-[2-(1-benzylpiperidin-3-yl)pyrrolidin-1-yl]-N-(2-chloro-4-methylphenyl)acetamide (PubChem CID 47084616) has the molecular formula C25H32ClN3O and a molecular weight of 426.00 g/mol. Its IUPAC name is 2-[2-(1-benzylpiperidin-3-yl)pyrrolidin-1-yl]-N-(2-chloro-4-methylphenyl)acetamide.
| Compound Name | 2-[2-(1-benzylpiperidin-3-yl)pyrrolidin-1-yl]-N-(2-chloro-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 47084616 |
| Molecular Formula | C25H32ClN3O |
| Molecular Weight | 426.00 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 2-[2-(1-benzylpiperidin-3-yl)pyrrolidin-1-yl]-N-(2-chloro-4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CN2CCCC2C2CCCN(Cc3ccccc3)C2)c(Cl)c1 |
| InChI | InChI=1S/C25H32ClN3O/c1-19-11-12-23(22(26)15-19)27-25(30)18-29-14-6-10-24(29)21-9-5-13-28(17-21)16-20-7-3-2-4-8-20/h2-4,7-8,11-12,15,21,24H,5-6,9-10,13-14,16-18H2,1H3,(H,27,30) |
| InChIKey | ZMFJFVWMLQEKEL-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.00 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |