C11H14N4O2S — CID 47084788
N-[2-(1-methylimidazol-2-yl)ethyl]pyridine-3-sulfonamide (PubChem CID 47084788) has the molecular formula C11H14N4O2S and a molecular weight of 266.33 g/mol. Its IUPAC name is N-[2-(1-methylimidazol-2-yl)ethyl]pyridine-3-sulfonamide.
| Compound Name | N-[2-(1-methylimidazol-2-yl)ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 47084788 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | N-[2-(1-methylimidazol-2-yl)ethyl]pyridine-3-sulfonamide |
| SMILES | Cn1ccnc1CCNS(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C11H14N4O2S/c1-15-8-7-13-11(15)4-6-14-18(16,17)10-3-2-5-12-9-10/h2-3,5,7-9,14H,4,6H2,1H3 |
| InChIKey | UIQPCKLFHKSDAP-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |