C13H13FN4O3 — CID 47087177
N-[(3-fluorophenyl)methyl]-N,5-dimethyl-4-nitro-1H-pyrazole-3-carboxamide (PubChem CID 47087177) has the molecular formula C13H13FN4O3 and a molecular weight of 292.27 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-N,5-dimethyl-4-nitro-1H-pyrazole-3-carboxamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-N,5-dimethyl-4-nitro-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 47087177 |
| Molecular Formula | C13H13FN4O3 |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-N,5-dimethyl-4-nitro-1H-pyrazole-3-carboxamide |
| SMILES | Cc1[nH]nc(C(=O)N(C)Cc2cccc(F)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H13FN4O3/c1-8-12(18(20)21)11(16-15-8)13(19)17(2)7-9-4-3-5-10(14)6-9/h3-6H,7H2,1-2H3,(H,15,16) |
| InChIKey | LKEJDYBBLOCAQF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 92.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|