C25H16F3N5O2S — CID 47087495
2-[(2-oxo-3-phenyl-[1,2,4]triazino[2,3-c]quinazolin-6-yl)sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 47087495) has the molecular formula C25H16F3N5O2S and a molecular weight of 507.50 g/mol. Its IUPAC name is 2-[(2-oxo-3-phenyl-[1,2,4]triazino[2,3-c]quinazolin-6-yl)sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(2-oxo-3-phenyl-[1,2,4]triazino[2,3-c]quinazolin-6-yl)sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 47087495 |
| Molecular Formula | C25H16F3N5O2S |
| Molecular Weight | 507.50 g/mol |
| Exact Mass | 507.10 |
| IUPAC Name | 2-[(2-oxo-3-phenyl-[1,2,4]triazino[2,3-c]quinazolin-6-yl)sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CSc1nc2ccccc2c2nc(=O)c(-c3ccccc3)nn12)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H16F3N5O2S/c26-25(27,28)16-9-6-10-17(13-16)29-20(34)14-36-24-30-19-12-5-4-11-18(19)22-31-23(35)21(32-33(22)24)15-7-2-1-3-8-15/h1-13H,14H2,(H,29,34) |
| InChIKey | NYILFPZFBAZILB-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.50 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|