C17H19ClN2O2 — CID 47088064
1-(3-chlorophenyl)-N-[2-oxo-2-(prop-2-ynylamino)ethyl]cyclopentane-1-carboxamide (PubChem CID 47088064) has the molecular formula C17H19ClN2O2 and a molecular weight of 318.80 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-[2-oxo-2-(prop-2-ynylamino)ethyl]cyclopentane-1-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-N-[2-oxo-2-(prop-2-ynylamino)ethyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 47088064 |
| Molecular Formula | C17H19ClN2O2 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 1-(3-chlorophenyl)-N-[2-oxo-2-(prop-2-ynylamino)ethyl]cyclopentane-1-carboxamide |
| SMILES | C#CCNC(=O)CNC(=O)C1(c2cccc(Cl)c2)CCCC1 |
| InChI | InChI=1S/C17H19ClN2O2/c1-2-10-19-15(21)12-20-16(22)17(8-3-4-9-17)13-6-5-7-14(18)11-13/h1,5-7,11H,3-4,8-10,12H2,(H,19,21)(H,20,22) |
| InChIKey | CUUFDABMYMZASC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|