C17H25N3O6S — CID 47088115
4-[(2S)-2-[(4-methoxyphenyl)sulfonylamino]-3-methylbutanoyl]morpholine-2-carboxamide (PubChem CID 47088115) has the molecular formula C17H25N3O6S and a molecular weight of 399.47 g/mol. Its IUPAC name is 4-[(2S)-2-[(4-methoxyphenyl)sulfonylamino]-3-methylbutanoyl]morpholine-2-carboxamide.
| Compound Name | 4-[(2S)-2-[(4-methoxyphenyl)sulfonylamino]-3-methylbutanoyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 47088115 |
| Molecular Formula | C17H25N3O6S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 4-[(2S)-2-[(4-methoxyphenyl)sulfonylamino]-3-methylbutanoyl]morpholine-2-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N[C@H](C(=O)N2CCOC(C(N)=O)C2)C(C)C)cc1 |
| InChI | InChI=1S/C17H25N3O6S/c1-11(2)15(17(22)20-8-9-26-14(10-20)16(18)21)19-27(23,24)13-6-4-12(25-3)5-7-13/h4-7,11,14-15,19H,8-10H2,1-3H3,(H2,18,21)/t14?,15-/m0/s1 |
| InChIKey | HWYNDUCLYYRPQC-LOACHALJSA-N |
| XLogP | -0.29 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |