C16H20N6O2S — CID 47088132
4-[(4-cyclopropyl-3-pyridin-3-yl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]morpholine-2-carboxamide (PubChem CID 47088132) has the molecular formula C16H20N6O2S and a molecular weight of 360.44 g/mol. Its IUPAC name is 4-[(4-cyclopropyl-3-pyridin-3-yl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]morpholine-2-carboxamide.
| Compound Name | 4-[(4-cyclopropyl-3-pyridin-3-yl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 47088132 |
| Molecular Formula | C16H20N6O2S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 4-[(4-cyclopropyl-3-pyridin-3-yl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]morpholine-2-carboxamide |
| SMILES | NC(=O)C1CN(Cn2nc(-c3cccnc3)n(C3CC3)c2=S)CCO1 |
| InChI | InChI=1S/C16H20N6O2S/c17-14(23)13-9-20(6-7-24-13)10-21-16(25)22(12-3-4-12)15(19-21)11-2-1-5-18-8-11/h1-2,5,8,12-13H,3-4,6-7,9-10H2,(H2,17,23) |
| InChIKey | YTJWQJVROQATTR-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 91.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|