C20H32N2O3 — CID 47088134
4-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]morpholine-2-carboxamide (PubChem CID 47088134) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is 4-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]morpholine-2-carboxamide.
| Compound Name | 4-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 47088134 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | 4-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]morpholine-2-carboxamide |
| SMILES | CC(C)(C)c1cc(CN2CCOC(C(N)=O)C2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H32N2O3/c1-19(2,3)14-9-13(17(23)15(10-14)20(4,5)6)11-22-7-8-25-16(12-22)18(21)24/h9-10,16,23H,7-8,11-12H2,1-6H3,(H2,21,24) |
| InChIKey | NTBYYNGMOIRFMR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|