C19H20N4O2 — CID 47090845
N,N-bis(cyanomethyl)-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide (PubChem CID 47090845) has the molecular formula C19H20N4O2 and a molecular weight of 336.39 g/mol. Its IUPAC name is N,N-bis(cyanomethyl)-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide.
| Compound Name | N,N-bis(cyanomethyl)-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 47090845 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | N,N-bis(cyanomethyl)-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide |
| SMILES | N#CCN(CC#N)C(=O)C1CCN(C(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C19H20N4O2/c20-10-14-23(15-11-21)19(25)17-8-12-22(13-9-17)18(24)7-6-16-4-2-1-3-5-16/h1-7,17H,8-9,12-15H2/b7-6+ |
| InChIKey | IWARIIAJEQOXHM-VOTSOKGWSA-N |
| XLogP | 1.81 |
| TPSA | 88.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|