C14H19N3O5 — CID 47090911
(E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-N-(oxan-2-yloxy)prop-2-enamide (PubChem CID 47090911) has the molecular formula C14H19N3O5 and a molecular weight of 309.32 g/mol. Its IUPAC name is (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-N-(oxan-2-yloxy)prop-2-enamide.
| Compound Name | (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-N-(oxan-2-yloxy)prop-2-enamide |
|---|---|
| PubChem CID | 47090911 |
| Molecular Formula | C14H19N3O5 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-N-(oxan-2-yloxy)prop-2-enamide |
| SMILES | Cn1cc(/C=C/C(=O)NOC2CCCCO2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C14H19N3O5/c1-16-9-10(13(19)17(2)14(16)20)6-7-11(18)15-22-12-5-3-4-8-21-12/h6-7,9,12H,3-5,8H2,1-2H3,(H,15,18)/b7-6+ |
| InChIKey | WZCPYIUYDPQXCX-VOTSOKGWSA-N |
| XLogP | -0.33 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|