C18H25NO4S — CID 47091971
2-(2-bicyclo[2.2.1]heptanyl)-N-[3-(2-methylsulfonylethoxy)phenyl]acetamide (PubChem CID 47091971) has the molecular formula C18H25NO4S and a molecular weight of 351.47 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-N-[3-(2-methylsulfonylethoxy)phenyl]acetamide.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-N-[3-(2-methylsulfonylethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 47091971 |
| Molecular Formula | C18H25NO4S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-N-[3-(2-methylsulfonylethoxy)phenyl]acetamide |
| SMILES | CS(=O)(=O)CCOc1cccc(NC(=O)CC2CC3CCC2C3)c1 |
| InChI | InChI=1S/C18H25NO4S/c1-24(21,22)8-7-23-17-4-2-3-16(12-17)19-18(20)11-15-10-13-5-6-14(15)9-13/h2-4,12-15H,5-11H2,1H3,(H,19,20) |
| InChIKey | MYXLULYFWMYPMZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |