C22H31FN2O4 — CID 47092142
tert-butyl N-[1-[1-[4-(4-fluorophenyl)-4-oxobutanoyl]piperidin-2-yl]ethyl]carbamate (PubChem CID 47092142) has the molecular formula C22H31FN2O4 and a molecular weight of 406.50 g/mol. Its IUPAC name is tert-butyl N-[1-[1-[4-(4-fluorophenyl)-4-oxobutanoyl]piperidin-2-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[1-[1-[4-(4-fluorophenyl)-4-oxobutanoyl]piperidin-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 47092142 |
| Molecular Formula | C22H31FN2O4 |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | tert-butyl N-[1-[1-[4-(4-fluorophenyl)-4-oxobutanoyl]piperidin-2-yl]ethyl]carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)C1CCCCN1C(=O)CCC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H31FN2O4/c1-15(24-21(28)29-22(2,3)4)18-7-5-6-14-25(18)20(27)13-12-19(26)16-8-10-17(23)11-9-16/h8-11,15,18H,5-7,12-14H2,1-4H3,(H,24,28) |
| InChIKey | UORFMVMJUAXIOV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |