C25H27FN4O2 — CID 47092268
4-[[(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)methyl-[(3-fluorophenyl)methyl]amino]methyl]benzonitrile (PubChem CID 47092268) has the molecular formula C25H27FN4O2 and a molecular weight of 434.52 g/mol. Its IUPAC name is 4-[[(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)methyl-[(3-fluorophenyl)methyl]amino]methyl]benzonitrile.
| Compound Name | 4-[[(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)methyl-[(3-fluorophenyl)methyl]amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 47092268 |
| Molecular Formula | C25H27FN4O2 |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 4-[[(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)methyl-[(3-fluorophenyl)methyl]amino]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN(Cc2cccc(F)c2)CN2C(=O)NC3(CCCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C25H27FN4O2/c26-22-7-5-6-21(14-22)17-29(16-20-10-8-19(15-27)9-11-20)18-30-23(31)25(28-24(30)32)12-3-1-2-4-13-25/h5-11,14H,1-4,12-13,16-18H2,(H,28,32) |
| InChIKey | CCYVCWXAIRBJDW-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|