C16H19BrN4O3 — CID 47092410
5-[(5-bromo-8-nitro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-3-butyl-1,2,4-oxadiazole (PubChem CID 47092410) has the molecular formula C16H19BrN4O3 and a molecular weight of 395.26 g/mol. Its IUPAC name is 5-[(5-bromo-8-nitro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-3-butyl-1,2,4-oxadiazole.
| Compound Name | 5-[(5-bromo-8-nitro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-3-butyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 47092410 |
| Molecular Formula | C16H19BrN4O3 |
| Molecular Weight | 395.26 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 5-[(5-bromo-8-nitro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-3-butyl-1,2,4-oxadiazole |
| SMILES | CCCCc1noc(CN2CCc3c(Br)ccc([N+](=O)[O-])c3C2)n1 |
| InChI | InChI=1S/C16H19BrN4O3/c1-2-3-4-15-18-16(24-19-15)10-20-8-7-11-12(9-20)14(21(22)23)6-5-13(11)17/h5-6H,2-4,7-10H2,1H3 |
| InChIKey | MPZNDXVIFSQDIL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 85.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.26 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|