C18H25N3O4 — CID 47092664
4-methoxy-N-[3-methyl-1-oxo-1-[(2-oxopiperidin-1-yl)amino]butan-2-yl]benzamide (PubChem CID 47092664) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is 4-methoxy-N-[3-methyl-1-oxo-1-[(2-oxopiperidin-1-yl)amino]butan-2-yl]benzamide.
| Compound Name | 4-methoxy-N-[3-methyl-1-oxo-1-[(2-oxopiperidin-1-yl)amino]butan-2-yl]benzamide |
|---|---|
| PubChem CID | 47092664 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 4-methoxy-N-[3-methyl-1-oxo-1-[(2-oxopiperidin-1-yl)amino]butan-2-yl]benzamide |
| SMILES | COc1ccc(C(=O)NC(C(=O)NN2CCCCC2=O)C(C)C)cc1 |
| InChI | InChI=1S/C18H25N3O4/c1-12(2)16(18(24)20-21-11-5-4-6-15(21)22)19-17(23)13-7-9-14(25-3)10-8-13/h7-10,12,16H,4-6,11H2,1-3H3,(H,19,23)(H,20,24) |
| InChIKey | SVDKTMKIUIAYQW-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |