C16H14FN3O3S — CID 47092917
N-(3-fluorophenyl)-2-(4-methyl-2,5-dioxo-4-thiophen-3-ylimidazolidin-1-yl)acetamide (PubChem CID 47092917) has the molecular formula C16H14FN3O3S and a molecular weight of 347.37 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-(4-methyl-2,5-dioxo-4-thiophen-3-ylimidazolidin-1-yl)acetamide.
| Compound Name | N-(3-fluorophenyl)-2-(4-methyl-2,5-dioxo-4-thiophen-3-ylimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 47092917 |
| Molecular Formula | C16H14FN3O3S |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | N-(3-fluorophenyl)-2-(4-methyl-2,5-dioxo-4-thiophen-3-ylimidazolidin-1-yl)acetamide |
| SMILES | CC1(c2ccsc2)NC(=O)N(CC(=O)Nc2cccc(F)c2)C1=O |
| InChI | InChI=1S/C16H14FN3O3S/c1-16(10-5-6-24-9-10)14(22)20(15(23)19-16)8-13(21)18-12-4-2-3-11(17)7-12/h2-7,9H,8H2,1H3,(H,18,21)(H,19,23) |
| InChIKey | UXDDSFBBHPESQV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|