C19H22N4O3S — CID 47094229
2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]acetamide (PubChem CID 47094229) has the molecular formula C19H22N4O3S and a molecular weight of 386.48 g/mol. Its IUPAC name is 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]acetamide.
| Compound Name | 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 47094229 |
| Molecular Formula | C19H22N4O3S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]acetamide |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)Nc2cccc(-c3csc(C)n3)c2)C1=O |
| InChI | InChI=1S/C19H22N4O3S/c1-4-19(5-2)17(25)23(18(26)22-19)10-16(24)21-14-8-6-7-13(9-14)15-11-27-12(3)20-15/h6-9,11H,4-5,10H2,1-3H3,(H,21,24)(H,22,26) |
| InChIKey | QFEFOOOZEAKMMJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|