C25H23N5O2S2 — CID 47094306
2-[[4-(furan-2-ylmethyl)-5-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-4-one (PubChem CID 47094306) has the molecular formula C25H23N5O2S2 and a molecular weight of 489.63 g/mol. Its IUPAC name is 2-[[4-(furan-2-ylmethyl)-5-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-4-one.
| Compound Name | 2-[[4-(furan-2-ylmethyl)-5-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-4-one |
|---|---|
| PubChem CID | 47094306 |
| Molecular Formula | C25H23N5O2S2 |
| Molecular Weight | 489.63 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | 2-[[4-(furan-2-ylmethyl)-5-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-4-one |
| SMILES | Cc1cccc(-c2nnc(SCc3cc(=O)n4c5c(sc4n3)CCCC5)n2Cc2ccco2)c1 |
| InChI | InChI=1S/C25H23N5O2S2/c1-16-6-4-7-17(12-16)23-27-28-25(29(23)14-19-8-5-11-32-19)33-15-18-13-22(31)30-20-9-2-3-10-21(20)34-24(30)26-18/h4-8,11-13H,2-3,9-10,14-15H2,1H3 |
| InChIKey | BMHANFWEKGRAHI-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 78.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.63 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |