C19H22BrN3O5S — CID 47094422
[2-[(5-bromothiophen-2-yl)methyl-prop-2-enylamino]-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate (PubChem CID 47094422) has the molecular formula C19H22BrN3O5S and a molecular weight of 484.37 g/mol. Its IUPAC name is [2-[(5-bromothiophen-2-yl)methyl-prop-2-enylamino]-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate.
| Compound Name | [2-[(5-bromothiophen-2-yl)methyl-prop-2-enylamino]-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
|---|---|
| PubChem CID | 47094422 |
| Molecular Formula | C19H22BrN3O5S |
| Molecular Weight | 484.37 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | [2-[(5-bromothiophen-2-yl)methyl-prop-2-enylamino]-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
| SMILES | C=CCN(Cc1ccc(Br)s1)C(=O)COC(=O)CN1C(=O)NC2(CCCC2)C1=O |
| InChI | InChI=1S/C19H22BrN3O5S/c1-2-9-22(10-13-5-6-14(20)29-13)15(24)12-28-16(25)11-23-17(26)19(21-18(23)27)7-3-4-8-19/h2,5-6H,1,3-4,7-12H2,(H,21,27) |
| InChIKey | ORBZGEZCRUULMB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|