About 3-[(3,5-dimethylphenyl)methylsulfanyl]imidazo[1,5-a]pyridine
3-[(3,5-dimethylphenyl)methylsulfanyl]imidazo[1,5-a]pyridine (PubChem CID 47096267) has the molecular formula C16H16N2S
and a molecular weight of 268.38 g/mol. Its IUPAC name is 3-[(3,5-dimethylphenyl)methylsulfanyl]imidazo[1,5-a]pyridine.
Molecular Properties
| Compound Name | 3-[(3,5-dimethylphenyl)methylsulfanyl]imidazo[1,5-a]pyridine |
| PubChem CID | 47096267 |
| Molecular Formula | C16H16N2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 3-[(3,5-dimethylphenyl)methylsulfanyl]imidazo[1,5-a]pyridine |
| SMILES | Cc1cc(C)cc(CSc2ncc3ccccn23)c1 |
| InChI | InChI=1S/C16H16N2S/c1-12-7-13(2)9-14(8-12)11-19-16-17-10-15-5-3-4-6-18(15)16/h3-10H,11H2,1-2H3 |
| InChIKey | XWGWAFSIUGOULC-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(3,5-dimethylphenyl)methylsulfanyl]imidazo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,5-dimethylphenyl)methylsulfanyl]imidazo[1,5-a]pyridine?
The IUPAC name of 3-[(3,5-dimethylphenyl)methylsulfanyl]imidazo[1,5-a]pyridine (CID 47096267) is 3-[(3,5-dimethylphenyl)methylsulfanyl]imidazo[1,5-a]pyridine.
What is the SMILES notation for 3-[(3,5-dimethylphenyl)methylsulfanyl]imidazo[1,5-a]pyridine?
The canonical SMILES for 3-[(3,5-dimethylphenyl)methylsulfanyl]imidazo[1,5-a]pyridine is Cc1cc(C)cc(CSc2ncc3ccccn23)c1.
What is the InChIKey of 3-[(3,5-dimethylphenyl)methylsulfanyl]imidazo[1,5-a]pyridine?
The InChIKey is XWGWAFSIUGOULC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2S/c1-12-7-13(2)9-14(8-12)11-19-16-17-10-15-5-3-4-6-18(15)16/h3-10H,11H2,1-2H3.
What are the key properties of 3-[(3,5-dimethylphenyl)methylsulfanyl]imidazo[1,5-a]pyridine?
3-[(3,5-dimethylphenyl)methylsulfanyl]imidazo[1,5-a]pyridine has a molecular weight of 268.38 g/mol, XLogP of 4.24, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,5-dimethylphenyl)methylsulfanyl]imidazo[1,5-a]pyridine is sourced from PubChem (CID 47096267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).