C13H17N3O2 — CID 47097542
[1-(3,4-dihydro-2H-quinolin-1-yl)-1-oxopropan-2-yl]urea (PubChem CID 47097542) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is [1-(3,4-dihydro-2H-quinolin-1-yl)-1-oxopropan-2-yl]urea.
| Compound Name | [1-(3,4-dihydro-2H-quinolin-1-yl)-1-oxopropan-2-yl]urea |
|---|---|
| PubChem CID | 47097542 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | [1-(3,4-dihydro-2H-quinolin-1-yl)-1-oxopropan-2-yl]urea |
| SMILES | CC(NC(N)=O)C(=O)N1CCCc2ccccc21 |
| InChI | InChI=1S/C13H17N3O2/c1-9(15-13(14)18)12(17)16-8-4-6-10-5-2-3-7-11(10)16/h2-3,5,7,9H,4,6,8H2,1H3,(H3,14,15,18) |
| InChIKey | DCDMTZVZOZNGRP-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |