C10H7ClF3N3OS — CID 47099152
(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-(2,2,2-trifluoroethyl)prop-2-enamide (PubChem CID 47099152) has the molecular formula C10H7ClF3N3OS and a molecular weight of 309.70 g/mol. Its IUPAC name is (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-(2,2,2-trifluoroethyl)prop-2-enamide.
| Compound Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-(2,2,2-trifluoroethyl)prop-2-enamide |
|---|---|
| PubChem CID | 47099152 |
| Molecular Formula | C10H7ClF3N3OS |
| Molecular Weight | 309.70 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-(2,2,2-trifluoroethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1c(Cl)nc2sccn12)NCC(F)(F)F |
| InChI | InChI=1S/C10H7ClF3N3OS/c11-8-6(17-3-4-19-9(17)16-8)1-2-7(18)15-5-10(12,13)14/h1-4H,5H2,(H,15,18)/b2-1+ |
| InChIKey | ZCIJPMGXBDADJZ-OWOJBTEDSA-N |
| XLogP | 2.74 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.70 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|