C11H12F3N3O3 — CID 47099164
2-(dimethylamino)-5-nitro-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 47099164) has the molecular formula C11H12F3N3O3 and a molecular weight of 291.23 g/mol. Its IUPAC name is 2-(dimethylamino)-5-nitro-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-(dimethylamino)-5-nitro-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 47099164 |
| Molecular Formula | C11H12F3N3O3 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 2-(dimethylamino)-5-nitro-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CN(C)c1ccc([N+](=O)[O-])cc1C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C11H12F3N3O3/c1-16(2)9-4-3-7(17(19)20)5-8(9)10(18)15-6-11(12,13)14/h3-5H,6H2,1-2H3,(H,15,18) |
| InChIKey | PXTISEDPSCYISQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|