C12H20N2O3S — CID 47104037
4-(2-ethylpiperidin-1-yl)sulfonyl-3,5-dimethyl-1,2-oxazole (PubChem CID 47104037) has the molecular formula C12H20N2O3S and a molecular weight of 272.37 g/mol. Its IUPAC name is 4-(2-ethylpiperidin-1-yl)sulfonyl-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-(2-ethylpiperidin-1-yl)sulfonyl-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 47104037 |
| Molecular Formula | C12H20N2O3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 4-(2-ethylpiperidin-1-yl)sulfonyl-3,5-dimethyl-1,2-oxazole |
| SMILES | CCC1CCCCN1S(=O)(=O)c1c(C)noc1C |
| InChI | InChI=1S/C12H20N2O3S/c1-4-11-7-5-6-8-14(11)18(15,16)12-9(2)13-17-10(12)3/h11H,4-8H2,1-3H3 |
| InChIKey | PIGQNLZXTJKQDK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |