C13H19N3O2S — CID 47104744
N-(ethylcarbamoyl)-2-(2-thiophen-2-ylpyrrolidin-1-yl)acetamide (PubChem CID 47104744) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is N-(ethylcarbamoyl)-2-(2-thiophen-2-ylpyrrolidin-1-yl)acetamide.
| Compound Name | N-(ethylcarbamoyl)-2-(2-thiophen-2-ylpyrrolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 47104744 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | N-(ethylcarbamoyl)-2-(2-thiophen-2-ylpyrrolidin-1-yl)acetamide |
| SMILES | CCNC(=O)NC(=O)CN1CCCC1c1cccs1 |
| InChI | InChI=1S/C13H19N3O2S/c1-2-14-13(18)15-12(17)9-16-7-3-5-10(16)11-6-4-8-19-11/h4,6,8,10H,2-3,5,7,9H2,1H3,(H2,14,15,17,18) |
| InChIKey | HFEJRVPKOSKRPT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |