C11H10ClNOS — CID 47105865
5-chloro-2-(2-methylprop-2-enylsulfanyl)-1,3-benzoxazole (PubChem CID 47105865) has the molecular formula C11H10ClNOS and a molecular weight of 239.73 g/mol. Its IUPAC name is 5-chloro-2-(2-methylprop-2-enylsulfanyl)-1,3-benzoxazole.
| Compound Name | 5-chloro-2-(2-methylprop-2-enylsulfanyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 47105865 |
| Molecular Formula | C11H10ClNOS |
| Molecular Weight | 239.73 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | 5-chloro-2-(2-methylprop-2-enylsulfanyl)-1,3-benzoxazole |
| SMILES | C=C(C)CSc1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C11H10ClNOS/c1-7(2)6-15-11-13-9-5-8(12)3-4-10(9)14-11/h3-5H,1,6H2,2H3 |
| InChIKey | YFVCGAWUKYPOJH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.73 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|