C15H17NOS — CID 47105922
2-[2-(2,6-dimethylphenoxy)ethylsulfanyl]pyridine (PubChem CID 47105922) has the molecular formula C15H17NOS and a molecular weight of 259.37 g/mol. Its IUPAC name is 2-[2-(2,6-dimethylphenoxy)ethylsulfanyl]pyridine.
| Compound Name | 2-[2-(2,6-dimethylphenoxy)ethylsulfanyl]pyridine |
|---|---|
| PubChem CID | 47105922 |
| Molecular Formula | C15H17NOS |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 2-[2-(2,6-dimethylphenoxy)ethylsulfanyl]pyridine |
| SMILES | Cc1cccc(C)c1OCCSc1ccccn1 |
| InChI | InChI=1S/C15H17NOS/c1-12-6-5-7-13(2)15(12)17-10-11-18-14-8-3-4-9-16-14/h3-9H,10-11H2,1-2H3 |
| InChIKey | SGIZUPOULBZSGQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|